CAS 925910-42-5 appears in our catalog under these names: 3,4-Difluoro-5-methoxyphenylboronic acid, 98%, (3,4–difluoro–5–methoxyphenyl)boronic acid, (3,4-Difluoro-5-methoxyphenyl)boronic acid 98%, 3,4-Difluoro-5-methoxyphenylboronic acid, 98%, 98%, (3,4-Difluoro-5-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 500mg, 100mg, 250mg, 2.5g.
(3,4-difluoro-5-methoxyphenyl)boronic acid (CAS 925910-42-5) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,4-difluoro-5-methoxyphenyl)boronic acid. InChIKey: PKWMIAHGHFOLHX-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (3,4-difluoro-5-methoxyphenyl)boronic acid |
| InChIKey | PKWMIAHGHFOLHX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)OC)(O)O |
Computed by PubChem (NCBI)