cas: 2246725-44-8 — see every product listed under this CAS number, including other names
(2,5-Dichloro-4-methylphenyl)boronic acid, 98% (CAS 2246725-44-8) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1515005-5g |
| cas | 2246725-44-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11495.05 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,5-dichloro-4-methylphenyl)boronic acid (CAS 2246725-44-8) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,5-dichloro-4-methylphenyl)boronic acid. InChIKey: ZNBGBNHMPJWBJV-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (2,5-dichloro-4-methylphenyl)boronic acid |
| InChIKey | ZNBGBNHMPJWBJV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)C)Cl)(O)O |
Computed by PubChem (NCBI)