CAS 957035-17-5 appears in our catalog under these names: (3,4-Dichloro-2-methylphenyl)boronic acid, 98%, (3,4–Dichloro–2–methylphenyl)boronic acid, (3,4-Dichloro-2-methylphenyl)boronic acid, 98%, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
(3,4-dichloro-2-methylphenyl)boronic acid (CAS 957035-17-5) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (3,4-dichloro-2-methylphenyl)boronic acid. InChIKey: FQMLZXAQSIOVFD-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (3,4-dichloro-2-methylphenyl)boronic acid |
| InChIKey | FQMLZXAQSIOVFD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)Cl)C)(O)O |
Computed by PubChem (NCBI)