CAS 1421934-04-4 appears in our catalog under these names: 2,4-Dichloro-5-methylphenylboronic acid, ≥95%, ≥95%, 2,4-Dichloro-5-methylphenylboronic acid, 98+%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
(2,4-dichloro-5-methylphenyl)boronic acid (CAS 1421934-04-4) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,4-dichloro-5-methylphenyl)boronic acid. InChIKey: YYVMGKREXGTWSF-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (2,4-dichloro-5-methylphenyl)boronic acid |
| InChIKey | YYVMGKREXGTWSF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)C)(O)O |
Computed by PubChem (NCBI)