Products 1421934-04-4

CAS 1421934-04-4 appears in our catalog under these names: 2,4-Dichloro-5-methylphenylboronic acid, ≥95%, ≥95%, 2,4-Dichloro-5-methylphenylboronic acid, 98+%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

(2,4-dichloro-5-methylphenyl)boronic acid (CAS 1421934-04-4) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,4-dichloro-5-methylphenyl)boronic acid. InChIKey: YYVMGKREXGTWSF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BCl2O2
Molecular weight204.85 g/mol
IUPAC name(2,4-dichloro-5-methylphenyl)boronic acid
InChIKeyYYVMGKREXGTWSF-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1Cl)Cl)C)(O)O

Computed by PubChem (NCBI)