Products 1451391-51-7

CAS 1451391-51-7 appears in our catalog under these names: (2,6–Dichloro–4–methylphenyl)boronic acid, (2,6-Dichloro-4-methylphenyl)boronic acid, 95%, 95%, (2,6-Dichloro-4-methylphenyl)boronic acid, 98%, (2,6-Dichloro-4-methylphenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,6-dichloro-4-methylphenyl)boronic acid (CAS 1451391-51-7) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,6-dichloro-4-methylphenyl)boronic acid. InChIKey: ZNIJWHBCKYZTFC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BCl2O2
Molecular weight204.85 g/mol
IUPAC name(2,6-dichloro-4-methylphenyl)boronic acid
InChIKeyZNIJWHBCKYZTFC-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1Cl)C)Cl)(O)O

Computed by PubChem (NCBI)