CAS 1451391-51-7 appears in our catalog under these names: (2,6–Dichloro–4–methylphenyl)boronic acid, (2,6-Dichloro-4-methylphenyl)boronic acid, 95%, 95%, (2,6-Dichloro-4-methylphenyl)boronic acid, 98%, (2,6-Dichloro-4-methylphenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 250mg, 1g.
(2,6-dichloro-4-methylphenyl)boronic acid (CAS 1451391-51-7) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,6-dichloro-4-methylphenyl)boronic acid. InChIKey: ZNIJWHBCKYZTFC-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (2,6-dichloro-4-methylphenyl)boronic acid |
| InChIKey | ZNIJWHBCKYZTFC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)C)Cl)(O)O |
Computed by PubChem (NCBI)