cas: 16611-67-9 — see every product listed under this CAS number, including other names
(2,5-Dichlorophenyl)(phenyl)methanone 98% (CAS 16611-67-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181433-5g |
| cas | 16611-67-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 209.06 Pln | |
| Ambeed | 500g | 420.44 Pln | |
| Ambeed | 1000g | 598.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181433 |
(2,5-dichlorophenyl)-phenylmethanone (CAS 16611-67-9) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2,5-dichlorophenyl)-phenylmethanone. InChIKey: FAVKIHMGRWRACA-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-phenylmethanone |
| InChIKey | FAVKIHMGRWRACA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)