cas: 16611-67-9 — see every product listed under this CAS number, including other names
2,5-Dichlorobenzophenone, 98% (CAS 16611-67-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018517-25G |
| cas | 16611-67-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 500g | 393.63 Pln | |
| Fluorochem | 1kg | 560.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dichlorophenyl)-phenylmethanone (CAS 16611-67-9) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2,5-dichlorophenyl)-phenylmethanone. InChIKey: FAVKIHMGRWRACA-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-phenylmethanone |
| InChIKey | FAVKIHMGRWRACA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)