(2,6-Difluoro-3-isopropoxyphenyl)boronic acid 98%
cas: 849062-04-0 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-isopropoxyphenyl)boronic acid 98% (CAS 849062-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A565006-250mg |
| cas | 849062-04-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 25g | 3129.38 Pln | |
| Ambeed | 100g | 9709.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A565006 |
(2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 849062-04-0) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: YMUAZQJBMFLGEI-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | YMUAZQJBMFLGEI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
B-(2,6-Difluoro-3-(1-methylethoxy)phenyl)boronic acid, B-[2,6-Difluoro-3-(1-methylethoxy)phenyl]boronic acid, 2,6-Difluoro-3-isopropoxyphenylboronic acid, (2,6-Difluoro-3-isopropoxyphenyl)boronic acid, (2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid, (2,6-Difluoro-3-isopropoxy-phenyl)boronic acid, YMUAZQJBMFLGEI-UHFFFAOYSA-N, (2,6-Difluoro-3-isopropoxyphenyl)boronicacid, 2,6-difluoro-3-isopropoxy-phenylboronic acid, {2,6-Difluoro-3-[(propan-2-yl)oxy]phenyl}boronic acid