(2,6-Difluorobenzyl)hydrazine hydrochloride, 97%
cas: 2682115-59-7 — see every product listed under this CAS number, including other names
(2,6-Difluorobenzyl)hydrazine hydrochloride, 97% (CAS 2682115-59-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F547918-250MG |
| cas | 2682115-59-7 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1304.77 Pln | |
| Fluorochem | 10g | 2382.51 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1154.69 Pln | |
| Ambeed | 10g | 1972.38 Pln | |
| Ambeed | 25g | 3869.19 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2,6-difluorophenyl)methylhydrazine;hydrochloride (CAS 2682115-59-7) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: (2,6-difluorophenyl)methylhydrazine;hydrochloride. InChIKey: GEAVMQQPPYEJOM-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF2N2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | (2,6-difluorophenyl)methylhydrazine;hydrochloride |
| InChIKey | GEAVMQQPPYEJOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CNN)F.Cl |
Computed by PubChem (NCBI)