Products 2368870-29-3
CAS 2368870-29-3 appears in our catalog under these names: 2,2-Difluoro-2-(pyridin-2-yl)ethan-1-amine hydrochloride, 97%, 2,2-Difluoro-2-(2-pyridyl)ethanamine hydrochloride, 97%, 97%, 2,2-difluoro-2-(2-pyridyl)ethanamine,hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2,2-difluoro-2-pyridin-2-ylethanamine;hydrochloride (CAS 2368870-29-3) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: 2,2-difluoro-2-pyridin-2-ylethanamine;hydrochloride. InChIKey: PIHMVJMICRXWDB-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF2N2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 2,2-difluoro-2-pyridin-2-ylethanamine;hydrochloride |
| InChIKey | PIHMVJMICRXWDB-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(CN)(F)F.Cl |
Computed by PubChem (NCBI)