Products 2682115-59-7
CAS 2682115-59-7 appears in our catalog under these names: (2,6-Difluorobenzyl)hydrazine hydrochloride, 97%, 97%, (2,6-Difluorobenzyl)hydrazine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2,6-difluorophenyl)methylhydrazine;hydrochloride (CAS 2682115-59-7) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: (2,6-difluorophenyl)methylhydrazine;hydrochloride. InChIKey: GEAVMQQPPYEJOM-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF2N2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | (2,6-difluorophenyl)methylhydrazine;hydrochloride |
| InChIKey | GEAVMQQPPYEJOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CNN)F.Cl |
Computed by PubChem (NCBI)