Products 2287340-25-2
CAS 2287340-25-2 is the registry number for 6-(1,1-Difluoroethyl)pyridin-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(1,1-difluoroethyl)pyridin-2-amine;hydrochloride (CAS 2287340-25-2) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: 6-(1,1-difluoroethyl)pyridin-2-amine;hydrochloride. InChIKey: MPBCEJWPRNLJOC-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF2N2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 6-(1,1-difluoroethyl)pyridin-2-amine;hydrochloride |
| InChIKey | MPBCEJWPRNLJOC-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CC=C1)N)(F)F.Cl |
Computed by PubChem (NCBI)