Products 1446360-19-5

CAS 1446360-19-5 appears in our catalog under these names: (2,4–Difluorobenzyl)hydrazine hydrochloride, (2,4-Difluorobenzyl)hydrazine hydrochloride, 97%, 97%, (2,4-Difluorobenzyl)hydrazine hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,4-difluorophenyl)methylhydrazine;hydrochloride (CAS 1446360-19-5) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: (2,4-difluorophenyl)methylhydrazine;hydrochloride. InChIKey: PRPUGLGWIQTLON-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClF2N2
Molecular weight194.61 g/mol
IUPAC name(2,4-difluorophenyl)methylhydrazine;hydrochloride
InChIKeyPRPUGLGWIQTLON-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)CNN.Cl

Computed by PubChem (NCBI)