CAS 1065267-25-5 is the registry number for 1-(3,5-Difluoropyridin-2-yl)ethanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3,5-difluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 1065267-25-5) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: 1-(3,5-difluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: UIWOVTDLYJATHF-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF2N2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 1-(3,5-difluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | UIWOVTDLYJATHF-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=N1)F)F)N.Cl |
Computed by PubChem (NCBI)