Products 1864073-05-1

CAS 1864073-05-1 appears in our catalog under these names: (3,5-Difluorobenzyl)hydrazine hydrochloride, 95%, (3,5–Difluorobenzyl)hydrazine hydrochloride, (3,5-Difluorobenzyl)hydrazine hydrochloride 95%, (3,5-Difluorobenzyl)hydrazine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 100g, 250g.

Structural formula: {0} (CAS {1})

(3,5-difluorophenyl)methylhydrazine;hydrochloride (CAS 1864073-05-1) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: (3,5-difluorophenyl)methylhydrazine;hydrochloride. InChIKey: ZFGZONCZZRVUMA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClF2N2
Molecular weight194.61 g/mol
IUPAC name(3,5-difluorophenyl)methylhydrazine;hydrochloride
InChIKeyZFGZONCZZRVUMA-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1F)F)CNN.Cl

Computed by PubChem (NCBI)