CAS 2701379-49-7 is the registry number for (S)-1-(3,5-Difluoropyridin-2-yl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S)-1-(3,5-difluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 2701379-49-7) is a chemical compound with the molecular formula C7H9ClF2N2 and a molecular weight of 194.61 g/mol. IUPAC name: (1S)-1-(3,5-difluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: UIWOVTDLYJATHF-WCCKRBBISA-N.
| Molecular formula | C7H9ClF2N2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | (1S)-1-(3,5-difluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | UIWOVTDLYJATHF-WCCKRBBISA-N |
| SMILES | C[C@@H](C1=C(C=C(C=N1)F)F)N.Cl |
Computed by PubChem (NCBI)