cas: 1218790-79-4 — see every product listed under this CAS number, including other names
(2-(2,2,2-Trifluoroethoxy)pyridin-3-yl)boronic acid, 98% (CAS 1218790-79-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A463937-25g |
| cas | 1218790-79-4 |
| size | 25g |
| availability | USA Stock: 20.25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 13304.83 Pln | |
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 3980.91 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 1972.38 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid (CAS 1218790-79-4) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [2-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid. InChIKey: IEXZQXIMOMPBOM-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [2-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid |
| InChIKey | IEXZQXIMOMPBOM-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)