CAS 1429874-11-2 appears in our catalog under these names: (2-methoxy-6-(trifluoromethyl)pyridin-3-yl)boronic acid, 98+%, (2–Methoxy–6–(trifluoromethyl)pyridin–3–yl)boronic acid, (2-Methoxy-6-(trifluoromethyl)pyridin-3-yl)boronic acid, (2-methoxy-6-(trifluoromethyl)pyridin-3-yl)boronic acid, 95%, 95%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 2,5g, 100mg.
[2-methoxy-6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1429874-11-2) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [2-methoxy-6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: RBIFHAWLTLCJFB-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [2-methoxy-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | RBIFHAWLTLCJFB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C(F)(F)F)OC)(O)O |
Computed by PubChem (NCBI)