CAS 2225176-66-7 is the registry number for 5–(METHOXY)–2–TRIFLUOROMETHYLPYRIDINE–4–BORONIC ACID. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[5-methoxy-2-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 2225176-66-7) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [5-methoxy-2-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: VHDULPLNGGERRP-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [5-methoxy-2-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | VHDULPLNGGERRP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)