Products 3099766-67-0
CAS 3099766-67-0 appears in our catalog under these names: (2-Methyl-6-(trifluoromethoxy)pyridin-3-yl)boronic acid, 98%, 98%, (2-Methyl-6-(trifluoromethoxy)pyridin-3-yl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
[2-methyl-6-(trifluoromethoxy)-3-pyridinyl]boronic acid (CAS 3099766-67-0) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [2-methyl-6-(trifluoromethoxy)-3-pyridinyl]boronic acid. InChIKey: RDUXZLOUDSNZAM-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [2-methyl-6-(trifluoromethoxy)-3-pyridinyl]boronic acid |
| InChIKey | RDUXZLOUDSNZAM-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OC(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)