Products 2241875-96-5
CAS 2241875-96-5 is the registry number for (2–(methoxy–d3)–6–(trifluoromethyl)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(trideuteriomethoxy)-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 2241875-96-5) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 223.96 g/mol. IUPAC name: [2-(trideuteriomethoxy)-6-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: ZGPJQGHMUXHGFB-FIBGUPNXSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 223.96 g/mol |
| IUPAC name | [2-(trideuteriomethoxy)-6-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | ZGPJQGHMUXHGFB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=N1)C(F)(F)F)B(O)O |
Computed by PubChem (NCBI)