CAS 1218790-79-4 appears in our catalog under these names: (2-(2,2,2-Trifluoroethoxy)pyridin-3-yl)boronic acid, 98%, 2-(2,2,2-Trifluoroethoxy)pyridine-3-boronic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g.
[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid (CAS 1218790-79-4) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [2-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid. InChIKey: IEXZQXIMOMPBOM-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [2-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid |
| InChIKey | IEXZQXIMOMPBOM-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)