cas: 1093407-58-9 — see every product listed under this CAS number, including other names
(2-(Trifluoromethyl)pyridin-4-yl)boronic acid, 97% (CAS 1093407-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222766-250MG |
| cas | 1093407-58-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1013.20 Pln | |
| Fluorochem | 10g | 1632.78 Pln | |
| Fluorochem | 25g | 3475.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[2-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 1093407-58-9) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [2-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: PHLLTVDZCKUNJN-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [2-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | PHLLTVDZCKUNJN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)