CAS 1162257-61-5 appears in our catalog under these names: 6-(Trifluoromethyl)pyridine-2-boronic acid, 95%, 6-(Trifluoromethyl)pyridine-2-boronic acid, 6-(Trifluoromethyl)pyridine-2-boronic acid, 95%, 95%, (6-(Trifluoromethyl)pyridin-2-yl)boronic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg.
[6-(trifluoromethyl)-2-pyridinyl]boronic acid (CAS 1162257-61-5) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [6-(trifluoromethyl)-2-pyridinyl]boronic acid. InChIKey: MPRJCLNUBHVSPK-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [6-(trifluoromethyl)-2-pyridinyl]boronic acid |
| InChIKey | MPRJCLNUBHVSPK-UHFFFAOYSA-N |
| SMILES | B(C1=NC(=CC=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)