CAS 2657618-00-1 is the registry number for (5-Amino-2,3,4-trifluorophenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-amino-2,3,4-trifluorophenyl)boronic acid (CAS 2657618-00-1) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: (5-amino-2,3,4-trifluorophenyl)boronic acid. InChIKey: FMNVSBZQBWERFH-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | (5-amino-2,3,4-trifluorophenyl)boronic acid |
| InChIKey | FMNVSBZQBWERFH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)F)N)(O)O |
Computed by PubChem (NCBI)