cas: 309977-93-3 — see every product listed under this CAS number, including other names
(2-FLUORO-4,6-DIMETHOXYPHENYL)BORONIC ACID, 98% (CAS 309977-93-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F841033-100MG |
| cas | 309977-93-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2736.55 Pln | |
| Fluorochem | 10g | 4688.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-fluoro-4,6-dimethoxyphenyl)boronic acid (CAS 309977-93-3) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-4,6-dimethoxyphenyl)boronic acid. InChIKey: VRYIYLGRLZLYPA-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-4,6-dimethoxyphenyl)boronic acid |
| InChIKey | VRYIYLGRLZLYPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)