CAS 1451392-13-4 appears in our catalog under these names: 2,3-Dimethoxy-6-fluorophenylboronic acid, 95%, (6-Fluoro-2,3-dimethoxyphenyl)boronic acid, 98%, (6-Fluoro-2,3-dimethoxyphenyl)boronic acid, (6-fluoro-2,3-dimethoxyphenyl)boronic acid, ≥95%, ≥95%, 2,3-Dimethoxy-6-fluorophenylboronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 2,5g.
(6-fluoro-2,3-dimethoxyphenyl)boronic acid (CAS 1451392-13-4) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (6-fluoro-2,3-dimethoxyphenyl)boronic acid. InChIKey: NLUMLIMEFPUAGS-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (6-fluoro-2,3-dimethoxyphenyl)boronic acid |
| InChIKey | NLUMLIMEFPUAGS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)OC)F)(O)O |
Computed by PubChem (NCBI)