CAS 488713-34-4 appears in our catalog under these names: 5-Fluoro-2-(methoxymethoxy)phenylboronic acid, 97%, (5-Fluoro-2-(methoxymethoxy)phenyl)boronic acid, 97%, 97%, (5-Fluoro-2-(methoxymethoxy)phenyl)boronic acid, 97%, (5-FLUORO-2-(METHOXYMETHOXY)PHENYL)BORONIC ACID PINACOL ESTER, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
[5-fluoro-2-(methoxymethoxy)phenyl]boronic acid (CAS 488713-34-4) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: [5-fluoro-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: AMHIODVERFMLIU-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | [5-fluoro-2-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | AMHIODVERFMLIU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCOC)(O)O |
Computed by PubChem (NCBI)