CAS 2121511-38-2 appears in our catalog under these names: (2-Fluoro-3,6-dimethoxyphenyl)boronic acid, 98%, 2,5-Dimethoxy-6-fluorophenylboronic acid, 95%, Boronic acid, B-(2-fluoro-3,6-dimethoxyphenyl)-, ≥95%, ≥95%, 2,5-Dimethoxy-6-fluorophenylboronic acid, 98%. Offered by: AmBeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(2-fluoro-3,6-dimethoxyphenyl)boronic acid (CAS 2121511-38-2) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-3,6-dimethoxyphenyl)boronic acid. InChIKey: ZYIRUPNSDJXFPM-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-3,6-dimethoxyphenyl)boronic acid |
| InChIKey | ZYIRUPNSDJXFPM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)