CAS 309977-93-3 appears in our catalog under these names: (2-Fluoro-4,6-dimethoxyphenyl)boronic acid, 95%, (2–Fluoro–4,6–dimethoxyphenyl)boronic acid, (2-Fluoro-4,6-dimethoxyphenyl)boronic acid 97%, (2-Fluoro-4,6-dimethoxyphenyl)boronic acid, 97%, 97%, (2-FLUORO-4,6-DIMETHOXYPHENYL)BORONIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g.
(2-fluoro-4,6-dimethoxyphenyl)boronic acid (CAS 309977-93-3) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-4,6-dimethoxyphenyl)boronic acid. InChIKey: VRYIYLGRLZLYPA-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-4,6-dimethoxyphenyl)boronic acid |
| InChIKey | VRYIYLGRLZLYPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)