CAS 949146-39-8 appears in our catalog under these names: 3-Fluoro-2,4-dimethoxyphenylboronic acid, 98%, (3-Fluoro-2,4-dimethoxyphenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(3-fluoro-2,4-dimethoxyphenyl)boronic acid (CAS 949146-39-8) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (3-fluoro-2,4-dimethoxyphenyl)boronic acid. InChIKey: BISXERIORTWMKJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (3-fluoro-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | BISXERIORTWMKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)F)OC)(O)O |
Computed by PubChem (NCBI)