CAS 2121512-88-5 appears in our catalog under these names: 2,3-Dimethoxy-4-fluorophenylboronic acid, 95%, (4-Fluoro-2,3-dimethoxyphenyl)boronic acid, 98%, (4-Fluoro-2,3-dimethoxyphenyl)boronic acid, 98%, 98%, 2,3-Dimethoxy-4-fluorophenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 500mg.
(4-fluoro-2,3-dimethoxyphenyl)boronic acid (CAS 2121512-88-5) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (4-fluoro-2,3-dimethoxyphenyl)boronic acid. InChIKey: WBDNGHQQERYTBH-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (4-fluoro-2,3-dimethoxyphenyl)boronic acid |
| InChIKey | WBDNGHQQERYTBH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC)OC)(O)O |
Computed by PubChem (NCBI)