CAS 900175-07-7 appears in our catalog under these names: 2-Fluoro-4,5-dimethoxyphenylboronic acid, 95%, (2-Fluoro-4,5-dimethoxyphenyl)boronic acid, 98%, (2-Fluoro-4,5-dimethoxyphenyl)boronic acid, ≥95%, ≥95%, 2-Fluoro-4,5-dimethoxyphenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(2-fluoro-4,5-dimethoxyphenyl)boronic acid (CAS 900175-07-7) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-4,5-dimethoxyphenyl)boronic acid. InChIKey: ZXESUNZYCLCARB-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-4,5-dimethoxyphenyl)boronic acid |
| InChIKey | ZXESUNZYCLCARB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)