(2-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, 98%
cas: 1218790-57-8 — see every product listed under this CAS number, including other names
(2-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, 98% (CAS 1218790-57-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A484811-250mg |
| cas | 1218790-57-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2295.00 Pln | |
| Ambeed | 10g | 3457.56 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 875.60 Pln | |
| Chemat | 5g | 2906.00 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2469.16 Pln | |
| BLDpharm | 10g | 3724.27 Pln | |
| Fluorochem | 250mg | 679.99 Pln | |
| Fluorochem | 1g | 1622.36 Pln | |
| Fluorochem | 5g | 5386.66 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2-fluoro-3-phenylphenyl)boronic acid (CAS 1218790-57-8) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: (2-fluoro-3-phenylphenyl)boronic acid. InChIKey: VLUZUMHBJXPCRW-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | (2-fluoro-3-phenylphenyl)boronic acid |
| InChIKey | VLUZUMHBJXPCRW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, (2-fluoro-3-phenylphenyl)boronic acid, 2-Fluorobiphenyl-3-ylboronic acid, 2-Fluorobiphenyl-3-boronicacid, (2-Fluoro-[1,1'-biphenyl]-3-yl)boronicacid, {2-fluoro-[1,1'-biphenyl]-3-yl}boronic acid, Boronic acid, B-(2-fluoro[1,1'-biphenyl]-3-yl)-, (2-fluoro-3-phenyl-phenyl)boronic acid, (2-Fluoro[1,1'-biphenyl]-3-yl)boronic acid