cas: 900175-07-7 — see every product listed under this CAS number, including other names
(2-Fluoro-4,5-dimethoxyphenyl)boronic acid, 98% (CAS 900175-07-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A717643-5g |
| cas | 900175-07-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15557.29 Pln | |
| AmBeed | 10g | 26474.56 Pln | |
| AmBeed | 25g | 51948.19 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-fluoro-4,5-dimethoxyphenyl)boronic acid (CAS 900175-07-7) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-4,5-dimethoxyphenyl)boronic acid. InChIKey: ZXESUNZYCLCARB-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-4,5-dimethoxyphenyl)boronic acid |
| InChIKey | ZXESUNZYCLCARB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)