(2-Fluoro-4-isopropoxyphenyl)boronic acid, 98%
cas: 586389-90-4 — see every product listed under this CAS number, including other names
(2-Fluoro-4-isopropoxyphenyl)boronic acid, 98% (CAS 586389-90-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A139923-250mg |
| cas | 586389-90-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 609.56 Pln | |
| Ambeed | 25g | 1933.44 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 203.29 Pln | |
| BLDpharm | 5g | 653.13 Pln | |
| BLDpharm | 25g | 2080.40 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 622.72 Pln | |
| Fluorochem | 10g | 1179.81 Pln | |
| Fluorochem | 25g | 2070.12 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-fluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 586389-90-4) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: UFYDUWGUTFJYHC-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | UFYDUWGUTFJYHC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Fluoro-4-isopropoxyphenyl)boronic acid, 2-fluoro-4-isopropoxyphenylboronic acid, (2-fluoro-4-propan-2-yloxyphenyl)boronic acid, (2-Fluoro-4-isopropoxy-phenyl)boronic acid, (2-Fluoro-4-isopropoxyphenyl)boronicacid, UFYDUWGUTFJYHC-UHFFFAOYSA-N, {2-Fluoro-4-[(propan-2-yl)oxy]phenyl}boronic acid, (2-Fluoro-4-isopropoxyphenyl)boronic acid(contains varying amounts of Anhydride)