Products 586389-90-4
CAS 586389-90-4 appears in our catalog under these names: 2-Fluoro-4-isopropoxyphenylboronic acid, 98%, 98%, (2-Fluoro-4-isopropoxyphenyl)boronic acid, 98%, (2–Fluoro–4–isopropoxyphenyl)boronic acid(contains varying amounts of Anhydride). Offered by: Chemat, Fluorochem, GLPBio. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
(2-fluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 586389-90-4) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: UFYDUWGUTFJYHC-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | UFYDUWGUTFJYHC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Fluoro-4-isopropoxyphenyl)boronic acid, 2-fluoro-4-isopropoxyphenylboronic acid, (2-fluoro-4-propan-2-yloxyphenyl)boronic acid, (2-Fluoro-4-isopropoxy-phenyl)boronic acid, (2-Fluoro-4-isopropoxyphenyl)boronicacid, UFYDUWGUTFJYHC-UHFFFAOYSA-N, {2-Fluoro-4-[(propan-2-yl)oxy]phenyl}boronic acid, (2-Fluoro-4-isopropoxyphenyl)boronic acid(contains varying amounts of Anhydride)