cas: 195609-18-8 — see every product listed under this CAS number, including other names
2-Fluoro-5-nitrophenylacetic acid 98% (CAS 195609-18-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A482110-1g |
| cas | 195609-18-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 987.81 Pln | |
| Ambeed | 500g | 4230.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A482110 |
2-(2-fluoro-5-nitrophenyl)acetic acid (CAS 195609-18-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(2-fluoro-5-nitrophenyl)acetic acid. InChIKey: IDWINSICBKJFBK-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(2-fluoro-5-nitrophenyl)acetic acid |
| InChIKey | IDWINSICBKJFBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CC(=O)O)F |
Computed by PubChem (NCBI)