(2-HYDROXY-4-(TRIFLUOROMETHYL)PHENYL)BORONIC ACID, 98%, 98%
cas: 1072951-50-8 — see every product listed under this CAS number, including other names
(2-HYDROXY-4-(TRIFLUOROMETHYL)PHENYL)BORONIC ACID, 98%, 98% (CAS 1072951-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119632-250mg |
| cas | 1072951-50-8 |
| size | 250mg |
| availability | 5000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 100g | 2142.80 Pln | |
| Chemat | 250g | 5229.20 Pln | |
| Chemat | 500g | 6768.00 Pln | |
| Chemat | 1kg | 12357.20 Pln | |
| Chemat | 10g | 390.80 Pln | |
| Chemat | 50g | 1235.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1072951-50-8) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: GYGNUMOLFBSVCL-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GYGNUMOLFBSVCL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)O)(O)O |
Computed by PubChem (NCBI)