cas: 866332-15-2 — see every product listed under this CAS number, including other names
(2-Methylbenzo[d]oxazol-6-yl)boronic acid 98% (CAS 866332-15-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A442988-250mg |
| cas | 866332-15-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 765.31 Pln | |
| Ambeed | 5g | 3251.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A442988 |
(2-methyl-1,3-benzoxazol-6-yl)boronic acid (CAS 866332-15-2) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-methyl-1,3-benzoxazol-6-yl)boronic acid. InChIKey: MFPJERIVTFQLEG-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-methyl-1,3-benzoxazol-6-yl)boronic acid |
| InChIKey | MFPJERIVTFQLEG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=C(O2)C)(O)O |
Computed by PubChem (NCBI)