Products 1346526-56-4
CAS 1346526-56-4 appears in our catalog under these names: Isoindolin-1-one-5-boronic acid, 98%, (1-Oxoisoindolin-5-yl)boronic acid, 95+%, 1-Oxoisoindolin-5-ylboronic acid, 97%, 97%, (1-Oxoisoindolin-5-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
(1-oxo-2,3-dihydroisoindol-5-yl)boronic acid (CAS 1346526-56-4) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (1-oxo-2,3-dihydroisoindol-5-yl)boronic acid. InChIKey: PHNVHDUWRDWRJL-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (1-oxo-2,3-dihydroisoindol-5-yl)boronic acid |
| InChIKey | PHNVHDUWRDWRJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=O)NC2)(O)O |
Computed by PubChem (NCBI)