CAS 1370535-30-0 is the registry number for 3-Oxoisoindolin-5-ylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-oxo-1,2-dihydroisoindol-5-yl)boronic acid (CAS 1370535-30-0) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (3-oxo-1,2-dihydroisoindol-5-yl)boronic acid. InChIKey: WXPUOOLWEMWSIK-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (3-oxo-1,2-dihydroisoindol-5-yl)boronic acid |
| InChIKey | WXPUOOLWEMWSIK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CNC2=O)C=C1)(O)O |
Computed by PubChem (NCBI)