CAS 866332-15-2 appears in our catalog under these names: (2-Methyl-1,3-benzoxazol-6-yl)boronic acid, 98%, (2-Methylbenzo[d]oxazol-6-yl)boronic acid, 98%, 98%, (2-Methylbenzo[d]oxazol-6-yl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(2-methyl-1,3-benzoxazol-6-yl)boronic acid (CAS 866332-15-2) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-methyl-1,3-benzoxazol-6-yl)boronic acid. InChIKey: MFPJERIVTFQLEG-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-methyl-1,3-benzoxazol-6-yl)boronic acid |
| InChIKey | MFPJERIVTFQLEG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=C(O2)C)(O)O |
Computed by PubChem (NCBI)