CAS 2377610-19-8 appears in our catalog under these names: (1-Oxoisoindolin-7-yl)boronic acid, 95%, (1-Oxoisoindolin-7-Yl)Boronic Acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
(3-oxo-1,2-dihydroisoindol-4-yl)boronic acid (CAS 2377610-19-8) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (3-oxo-1,2-dihydroisoindol-4-yl)boronic acid. InChIKey: ACRZNEWLRUSEEN-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (3-oxo-1,2-dihydroisoindol-4-yl)boronic acid |
| InChIKey | ACRZNEWLRUSEEN-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)CNC2=O)(O)O |
Computed by PubChem (NCBI)