CAS 279262-85-0 appears in our catalog under these names: 2-Methyl-1,3-benzoxazole-5-boronic acid, 96%, (2-Methylbenzo[d]oxazol-5-yl)boronic acid 98%, (2-Methylbenzo[d]oxazol-5-yl)boronic acid, 98%, 98%, (2-Methylbenzo[d]oxazol-5-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2-methyl-1,3-benzoxazol-5-yl)boronic acid (CAS 279262-85-0) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-methyl-1,3-benzoxazol-5-yl)boronic acid. InChIKey: YFPFSHFWNVZLJZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-methyl-1,3-benzoxazol-5-yl)boronic acid |
| InChIKey | YFPFSHFWNVZLJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(=N2)C)(O)O |
Computed by PubChem (NCBI)