Products 1164100-84-8
CAS 1164100-84-8 appears in our catalog under these names: 2-Cyano-3-methoxyphenylboronic acid, 95%, 2-Cyano-3-methoxybenzeneboronic acid, 95% , 2-Cyano-3-methoxyphenylboronic acid, ≥95%, ≥95%, (2-Cyano-3-methoxyphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2-cyano-3-methoxyphenyl)boronic acid (CAS 1164100-84-8) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-cyano-3-methoxyphenyl)boronic acid. InChIKey: GRHINHWGIHWEPE-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-cyano-3-methoxyphenyl)boronic acid |
| InChIKey | GRHINHWGIHWEPE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC)C#N)(O)O |
Computed by PubChem (NCBI)