Products 1233968-22-3
CAS 1233968-22-3 appears in our catalog under these names: 2-Cyano-4-methoxyphenylboronic acid, 97%, 2-Cyano-4-methoxyphenylboronic acid, 95-<97%, 2-Cyano-4-methoxyphenylboronic acid, ≥97-<99%, 2–Cyano–4–methoxyphenylboronic Acid, 2-Cyano-4-methoxyphenylboronic Acid 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 2,5g, 10g, 25g, 50g, 100g.
(2-cyano-4-methoxyphenyl)boronic acid (CAS 1233968-22-3) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-cyano-4-methoxyphenyl)boronic acid. InChIKey: GZCUBWKIKPSBPB-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-cyano-4-methoxyphenyl)boronic acid |
| InChIKey | GZCUBWKIKPSBPB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C#N)(O)O |
Computed by PubChem (NCBI)