cas: 5834-17-3 — see every product listed under this CAS number, including other names
(2-methoxydibenzo[b,d]furan-3-yl)amine, 98% (CAS 5834-17-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F374667-1G |
| cas | 5834-17-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 25g | 570.65 Pln | |
| Fluorochem | 100g | 1757.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-methoxydibenzofuran-3-amine (CAS 5834-17-3) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2-methoxydibenzofuran-3-amine. InChIKey: SGQVWNYSHWQNOS-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-methoxydibenzofuran-3-amine |
| InChIKey | SGQVWNYSHWQNOS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=CC=CC=C3O2)N |
Computed by PubChem (NCBI)