cas: 5834-17-3 — see every product listed under this CAS number, including other names
2-Methoxydibenzo[b,d]furan-3-amine, 98%, 98% (CAS 5834-17-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E07H-1g |
| cas | 5834-17-3 |
| size | 1g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 362.00 Pln | |
| Chemat | 100g | 1077.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methoxydibenzofuran-3-amine (CAS 5834-17-3) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2-methoxydibenzofuran-3-amine. InChIKey: SGQVWNYSHWQNOS-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-methoxydibenzofuran-3-amine |
| InChIKey | SGQVWNYSHWQNOS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=CC=CC=C3O2)N |
Computed by PubChem (NCBI)