cas: 132376-67-1 — see every product listed under this CAS number, including other names
(2E)-3-(1-BENZOFURAN-2-YL)ACRYLIC ACID, 97% (CAS 132376-67-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468867-50MG |
| cas | 132376-67-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 357.18 Pln | |
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 500mg | 1060.06 Pln | |
| Fluorochem | 1g | 1320.39 Pln | |
| Fluorochem | 2.5g | 2361.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(E)-3-(1-benzofuran-2-yl)prop-2-enoic acid (CAS 132376-67-1) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: (E)-3-(1-benzofuran-2-yl)prop-2-enoic acid. InChIKey: SCFAXPKHRUZJFC-AATRIKPKSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (E)-3-(1-benzofuran-2-yl)prop-2-enoic acid |
| InChIKey | SCFAXPKHRUZJFC-AATRIKPKSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)/C=C/C(=O)O |
Computed by PubChem (NCBI)